About pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate
pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate (PubChem CID 61322383) has the molecular formula C15H17N3O2
and a molecular weight of 271.32 g/mol. Its IUPAC name is pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate |
| PubChem CID | 61322383 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate |
| SMILES | CN(C)c1ccc(N)cc1C(=O)OCc1cccnc1 |
| InChI | InChI=1S/C15H17N3O2/c1-18(2)14-6-5-12(16)8-13(14)15(19)20-10-11-4-3-7-17-9-11/h3-9H,10,16H2,1-2H3 |
| InChIKey | AEIKKLOEHSHMFA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate?
The IUPAC name of pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate (CID 61322383) is pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate.
What is the SMILES notation for pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate?
The canonical SMILES for pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate is CN(C)c1ccc(N)cc1C(=O)OCc1cccnc1.
What is the InChIKey of pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate?
The InChIKey is AEIKKLOEHSHMFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O2/c1-18(2)14-6-5-12(16)8-13(14)15(19)20-10-11-4-3-7-17-9-11/h3-9H,10,16H2,1-2H3.
What are the key properties of pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate?
pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate has a molecular weight of 271.32 g/mol, XLogP of 2.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 5-amino-2-(dimethylamino)benzoate is sourced from PubChem (CID 61322383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).