C14H15BrFN3O2 — CID 103223196
5-(3-aminopropoxy)-2-[(4-bromo-2-fluorophenyl)methyl]pyridazin-3-one (PubChem CID 103223196) has the molecular formula C14H15BrFN3O2 and a molecular weight of 356.20 g/mol. Its IUPAC name is 5-(3-aminopropoxy)-2-[(4-bromo-2-fluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(3-aminopropoxy)-2-[(4-bromo-2-fluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103223196 |
| Molecular Formula | C14H15BrFN3O2 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 5-(3-aminopropoxy)-2-[(4-bromo-2-fluorophenyl)methyl]pyridazin-3-one |
| SMILES | NCCCOc1cnn(Cc2ccc(Br)cc2F)c(=O)c1 |
| InChI | InChI=1S/C14H15BrFN3O2/c15-11-3-2-10(13(16)6-11)9-19-14(20)7-12(8-18-19)21-5-1-4-17/h2-3,6-8H,1,4-5,9,17H2 |
| InChIKey | HCRDSGYKWGIGDS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|