C14H15F2N3O2 — CID 103223131
5-(3-aminopropoxy)-2-[(2,5-difluorophenyl)methyl]pyridazin-3-one (PubChem CID 103223131) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 5-(3-aminopropoxy)-2-[(2,5-difluorophenyl)methyl]pyridazin-3-one.
| Compound Name | 5-(3-aminopropoxy)-2-[(2,5-difluorophenyl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 103223131 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 5-(3-aminopropoxy)-2-[(2,5-difluorophenyl)methyl]pyridazin-3-one |
| SMILES | NCCCOc1cnn(Cc2cc(F)ccc2F)c(=O)c1 |
| InChI | InChI=1S/C14H15F2N3O2/c15-11-2-3-13(16)10(6-11)9-19-14(20)7-12(8-18-19)21-5-1-4-17/h2-3,6-8H,1,4-5,9,17H2 |
| InChIKey | QEFBYHMVVFSPHS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|