C14H16BrFN4O — CID 103223623
2-[(4-bromo-2-fluorophenyl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one (PubChem CID 103223623) has the molecular formula C14H16BrFN4O and a molecular weight of 355.21 g/mol. Its IUPAC name is 2-[(4-bromo-2-fluorophenyl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one.
| Compound Name | 2-[(4-bromo-2-fluorophenyl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 103223623 |
| Molecular Formula | C14H16BrFN4O |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.05 |
| IUPAC Name | 2-[(4-bromo-2-fluorophenyl)methyl]-5-[2-(methylamino)ethylamino]pyridazin-3-one |
| SMILES | CNCCNc1cnn(Cc2ccc(Br)cc2F)c(=O)c1 |
| InChI | InChI=1S/C14H16BrFN4O/c1-17-4-5-18-12-7-14(21)20(19-8-12)9-10-2-3-11(15)6-13(10)16/h2-3,6-8,17-18H,4-5,9H2,1H3 |
| InChIKey | RQLXEHWYXNYRDD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|