C14H7F2IN2O2S — CID 157442639
4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazole-6-carboxylic acid (PubChem CID 157442639) has the molecular formula C14H7F2IN2O2S and a molecular weight of 432.19 g/mol. Its IUPAC name is 4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazole-6-carboxylic acid.
| Compound Name | 4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 157442639 |
| Molecular Formula | C14H7F2IN2O2S |
| Molecular Weight | 432.19 g/mol |
| Exact Mass | 431.92 |
| IUPAC Name | 4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazole-6-carboxylic acid |
| SMILES | O=C(O)c1cc2snnc2c(F)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C14H7F2IN2O2S/c15-10-4-7(17)2-1-6(10)3-8-9(14(20)21)5-11-13(12(8)16)18-19-22-11/h1-2,4-5H,3H2,(H,20,21) |
| InChIKey | DNSHJOIGPDXCIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|