C13H9BrFIN2O — CID 58431460
2-bromo-5-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide (PubChem CID 58431460) has the molecular formula C13H9BrFIN2O and a molecular weight of 435.03 g/mol. Its IUPAC name is 2-bromo-5-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-bromo-5-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 58431460 |
| Molecular Formula | C13H9BrFIN2O |
| Molecular Weight | 435.03 g/mol |
| Exact Mass | 433.89 |
| IUPAC Name | 2-bromo-5-[(2-fluoro-4-iodophenyl)methyl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1cc(Br)ncc1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C13H9BrFIN2O/c14-12-5-10(13(17)19)8(6-18-12)3-7-1-2-9(16)4-11(7)15/h1-2,4-6H,3H2,(H2,17,19) |
| InChIKey | CSWSZIHMXOCKHD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.03 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|