About (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate
(4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate (PubChem CID 161186982) has the molecular formula C15H12Br2F2O3
and a molecular weight of 438.06 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate |
| PubChem CID | 161186982 |
| Molecular Formula | C15H12Br2F2O3 |
| Molecular Weight | 438.06 g/mol |
| Exact Mass | 435.91 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(Br)cc1F.OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C8H6BrFO2.C7H6BrFO/c1-12-8(11)6-3-2-5(9)4-7(6)10;8-6-2-1-5(4-10)7(9)3-6/h2-4H,1H3;1-3,10H,4H2 |
| InChIKey | UTFDFVZBWFJPNY-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.06 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate?
The IUPAC name of (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate (CID 161186982) is (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate.
What is the SMILES notation for (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate?
The canonical SMILES for (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate is COC(=O)c1ccc(Br)cc1F.OCc1ccc(Br)cc1F.
What is the InChIKey of (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate?
The InChIKey is UTFDFVZBWFJPNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrFO2.C7H6BrFO/c1-12-8(11)6-3-2-5(9)4-7(6)10;8-6-2-1-5(4-10)7(9)3-6/h2-4H,1H3;1-3,10H,4H2.
What are the key properties of (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate?
(4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate has a molecular weight of 438.06 g/mol, XLogP of 4.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromo-2-fluorophenyl)methanol;methyl 4-bromo-2-fluorobenzoate is sourced from PubChem (CID 161186982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).