C16H14F2IN3O4 — CID 42606558
3-fluoro-4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-oxo-1-azabicyclo[4.2.0]octa-3,5-diene-5-carboxamide (PubChem CID 42606558) has the molecular formula C16H14F2IN3O4 and a molecular weight of 477.21 g/mol. Its IUPAC name is 3-fluoro-4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-oxo-1-azabicyclo[4.2.0]octa-3,5-diene-5-carboxamide.
| Compound Name | 3-fluoro-4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-oxo-1-azabicyclo[4.2.0]octa-3,5-diene-5-carboxamide |
|---|---|
| PubChem CID | 42606558 |
| Molecular Formula | C16H14F2IN3O4 |
| Molecular Weight | 477.21 g/mol |
| Exact Mass | 477.00 |
| IUPAC Name | 3-fluoro-4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-oxo-1-azabicyclo[4.2.0]octa-3,5-diene-5-carboxamide |
| SMILES | O=C(NOCCO)c1c(Nc2ccc(I)cc2F)c(F)c(=O)n2c1CC2 |
| InChI | InChI=1S/C16H14F2IN3O4/c17-9-7-8(19)1-2-10(9)20-14-12(15(24)21-26-6-5-23)11-3-4-22(11)16(25)13(14)18/h1-2,7,20,23H,3-6H2,(H,21,24) |
| InChIKey | MLUKRVVIFDZLBN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|