C17H16FIN2O4S — CID 164969979
5-cyano-N-[(2R)-2,3-dihydroxypropoxy]-2-[(2-fluoro-4-iodophenyl)methyl]-4-methylthiophene-3-carboxamide (PubChem CID 164969979) has the molecular formula C17H16FIN2O4S and a molecular weight of 490.29 g/mol. Its IUPAC name is 5-cyano-N-[(2R)-2,3-dihydroxypropoxy]-2-[(2-fluoro-4-iodophenyl)methyl]-4-methylthiophene-3-carboxamide.
| Compound Name | 5-cyano-N-[(2R)-2,3-dihydroxypropoxy]-2-[(2-fluoro-4-iodophenyl)methyl]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 164969979 |
| Molecular Formula | C17H16FIN2O4S |
| Molecular Weight | 490.29 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 5-cyano-N-[(2R)-2,3-dihydroxypropoxy]-2-[(2-fluoro-4-iodophenyl)methyl]-4-methylthiophene-3-carboxamide |
| SMILES | Cc1c(C#N)sc(Cc2ccc(I)cc2F)c1C(=O)NOC[C@H](O)CO |
| InChI | InChI=1S/C17H16FIN2O4S/c1-9-15(6-20)26-14(4-10-2-3-11(19)5-13(10)18)16(9)17(24)21-25-8-12(23)7-22/h2-3,5,12,22-23H,4,7-8H2,1H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | CZKTXMYSIDLBDE-GFCCVEGCSA-N |
| XLogP | 2.28 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.29 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|