C20H19FINO3S — CID 165073021
N-(cyclopropylmethoxy)-2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxamide (PubChem CID 165073021) has the molecular formula C20H19FINO3S and a molecular weight of 499.35 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 165073021 |
| Molecular Formula | C20H19FINO3S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.01 |
| IUPAC Name | N-(cyclopropylmethoxy)-2-[(2-fluoro-4-iodophenyl)methyl]-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxamide |
| SMILES | O=C1CCCc2c1sc(Cc1ccc(I)cc1F)c2C(=O)NOCC1CC1 |
| InChI | InChI=1S/C20H19FINO3S/c21-15-9-13(22)7-6-12(15)8-17-18(20(25)23-26-10-11-4-5-11)14-2-1-3-16(24)19(14)27-17/h6-7,9,11H,1-5,8,10H2,(H,23,25) |
| InChIKey | TVQACUKLWZEWJR-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|