C20H24FNO3SSi — CID 147439705
ethyl 2-(2-fluoro-4-trimethylsilylanilino)-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate (PubChem CID 147439705) has the molecular formula C20H24FNO3SSi and a molecular weight of 405.57 g/mol. Its IUPAC name is ethyl 2-(2-fluoro-4-trimethylsilylanilino)-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-fluoro-4-trimethylsilylanilino)-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 147439705 |
| Molecular Formula | C20H24FNO3SSi |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | ethyl 2-(2-fluoro-4-trimethylsilylanilino)-7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc([Si](C)(C)C)cc2F)sc2c1CCCC2=O |
| InChI | InChI=1S/C20H24FNO3SSi/c1-5-25-20(24)17-13-7-6-8-16(23)18(13)26-19(17)22-15-10-9-12(11-14(15)21)27(2,3)4/h9-11,22H,5-8H2,1-4H3 |
| InChIKey | DVZHGXSXRDMXQI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|