C19H22FN3O2Si — CID 59596662
ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1H-pyrrolo[3,2-c]pyridine-2-carboxylate (PubChem CID 59596662) has the molecular formula C19H22FN3O2Si and a molecular weight of 371.49 g/mol. Its IUPAC name is ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1H-pyrrolo[3,2-c]pyridine-2-carboxylate.
| Compound Name | ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 59596662 |
| Molecular Formula | C19H22FN3O2Si |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | ethyl 3-(2-fluoro-4-trimethylsilylanilino)-1H-pyrrolo[3,2-c]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccncc2c1Nc1ccc([Si](C)(C)C)cc1F |
| InChI | InChI=1S/C19H22FN3O2Si/c1-5-25-19(24)18-17(13-11-21-9-8-15(13)22-18)23-16-7-6-12(10-14(16)20)26(2,3)4/h6-11,22-23H,5H2,1-4H3 |
| InChIKey | RVBDPGQPMUMLKC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|