C16H17FN2OSi — CID 141210548
N-(2-fluoro-4-trimethylsilylphenyl)furo[3,2-c]pyridin-3-amine (PubChem CID 141210548) has the molecular formula C16H17FN2OSi and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(2-fluoro-4-trimethylsilylphenyl)furo[3,2-c]pyridin-3-amine.
| Compound Name | N-(2-fluoro-4-trimethylsilylphenyl)furo[3,2-c]pyridin-3-amine |
|---|---|
| PubChem CID | 141210548 |
| Molecular Formula | C16H17FN2OSi |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | N-(2-fluoro-4-trimethylsilylphenyl)furo[3,2-c]pyridin-3-amine |
| SMILES | C[Si](C)(C)c1ccc(Nc2coc3ccncc23)c(F)c1 |
| InChI | InChI=1S/C16H17FN2OSi/c1-21(2,3)11-4-5-14(13(17)8-11)19-15-10-20-16-6-7-18-9-12(15)16/h4-10,19H,1-3H3 |
| InChIKey | GHCPNCKXIMACMF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|