C17H19FN2O4Si — CID 156808759
5-(2-fluoro-4-trimethylsilylanilino)-4-methoxycarbonylpyridine-2-carboxylic acid (PubChem CID 156808759) has the molecular formula C17H19FN2O4Si and a molecular weight of 362.43 g/mol. Its IUPAC name is 5-(2-fluoro-4-trimethylsilylanilino)-4-methoxycarbonylpyridine-2-carboxylic acid.
| Compound Name | 5-(2-fluoro-4-trimethylsilylanilino)-4-methoxycarbonylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 156808759 |
| Molecular Formula | C17H19FN2O4Si |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 5-(2-fluoro-4-trimethylsilylanilino)-4-methoxycarbonylpyridine-2-carboxylic acid |
| SMILES | COC(=O)c1cc(C(=O)O)ncc1Nc1ccc([Si](C)(C)C)cc1F |
| InChI | InChI=1S/C17H19FN2O4Si/c1-24-17(23)11-8-14(16(21)22)19-9-15(11)20-13-6-5-10(7-12(13)18)25(2,3)4/h5-9,20H,1-4H3,(H,21,22) |
| InChIKey | MIKFTQUGMVFOOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|