methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate

C14H10ClFN2O3 — CID 122140941

IUPACmethyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate
SMILESCOC(=O)c1ccc(NC(=O)c2ccc(Cl)cn2)c(F)c1
InChIInChI=1S/C14H10ClFN2O3/c1-21-14(20)8-2-4-11(10(16)6-8)18-13(19)12-5-3-9(15)7-17-12/h2-7H,1H3,(H,18,19)
InChIKeyHWCZQQXYFOQUTP-UHFFFAOYSA-N
MW308.70 g/mol
LogP2.91
Rot. Bonds3

About methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate

methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate (PubChem CID 122140941) has the molecular formula C14H10ClFN2O3 and a molecular weight of 308.70 g/mol. Its IUPAC name is methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate.

Molecular Properties

Compound Namemethyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate
PubChem CID122140941
Molecular FormulaC14H10ClFN2O3
Molecular Weight308.70 g/mol
Exact Mass308.04
IUPAC Namemethyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate
SMILESCOC(=O)c1ccc(NC(=O)c2ccc(Cl)cn2)c(F)c1
InChIInChI=1S/C14H10ClFN2O3/c1-21-14(20)8-2-4-11(10(16)6-8)18-13(19)12-5-3-9(15)7-17-12/h2-7H,1H3,(H,18,19)
InChIKeyHWCZQQXYFOQUTP-UHFFFAOYSA-N
XLogP2.91
TPSA68.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.70
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate?
The IUPAC name of methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate (CID 122140941) is methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate.
What is the SMILES notation for methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate?
The canonical SMILES for methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate is COC(=O)c1ccc(NC(=O)c2ccc(Cl)cn2)c(F)c1.
What is the InChIKey of methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate?
The InChIKey is HWCZQQXYFOQUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10ClFN2O3/c1-21-14(20)8-2-4-11(10(16)6-8)18-13(19)12-5-3-9(15)7-17-12/h2-7H,1H3,(H,18,19).
What are the key properties of methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate?
methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate has a molecular weight of 308.70 g/mol, XLogP of 2.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(5-chloropyridine-2-carbonyl)amino]-3-fluorobenzoate is sourced from PubChem (CID 122140941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).