C15H13FN2O3 — CID 31809423
methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]pyridine-3-carboxylate (PubChem CID 31809423) has the molecular formula C15H13FN2O3 and a molecular weight of 288.28 g/mol. Its IUPAC name is methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 31809423 |
| Molecular Formula | C15H13FN2O3 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 6-[(3-fluoro-4-methylphenyl)carbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(C)c(F)c2)nc1 |
| InChI | InChI=1S/C15H13FN2O3/c1-9-3-5-11(7-12(9)16)18-14(19)13-6-4-10(8-17-13)15(20)21-2/h3-8H,1-2H3,(H,18,19) |
| InChIKey | JDXXJJVKOVTNOS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |