C16H16N2O3 — CID 31695014
methyl 6-[(3,4-dimethylphenyl)carbamoyl]pyridine-3-carboxylate (PubChem CID 31695014) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 6-[(3,4-dimethylphenyl)carbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[(3,4-dimethylphenyl)carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 31695014 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | methyl 6-[(3,4-dimethylphenyl)carbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(C)c(C)c2)nc1 |
| InChI | InChI=1S/C16H16N2O3/c1-10-4-6-13(8-11(10)2)18-15(19)14-7-5-12(9-17-14)16(20)21-3/h4-9H,1-3H3,(H,18,19) |
| InChIKey | GFLQUZPDEUXLDB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |