C21H18ClN3O3 — CID 109199478
methyl 4-[[6-[(3-chloro-4-methylphenyl)carbamoyl]-3-pyridinyl]amino]benzoate (PubChem CID 109199478) has the molecular formula C21H18ClN3O3 and a molecular weight of 395.85 g/mol. Its IUPAC name is methyl 4-[[6-[(3-chloro-4-methylphenyl)carbamoyl]-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[6-[(3-chloro-4-methylphenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109199478 |
| Molecular Formula | C21H18ClN3O3 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | methyl 4-[[6-[(3-chloro-4-methylphenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc(C(=O)Nc3ccc(C)c(Cl)c3)nc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O3/c1-13-3-6-16(11-18(13)22)25-20(26)19-10-9-17(12-23-19)24-15-7-4-14(5-8-15)21(27)28-2/h3-12,24H,1-2H3,(H,25,26) |
| InChIKey | AZUCGGXCLZCFGD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |