C20H16ClN3O3 — CID 109199100
methyl 4-[[6-[(2-chlorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate (PubChem CID 109199100) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is methyl 4-[[6-[(2-chlorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate.
| Compound Name | methyl 4-[[6-[(2-chlorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
|---|---|
| PubChem CID | 109199100 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | methyl 4-[[6-[(2-chlorophenyl)carbamoyl]-3-pyridinyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ccc(C(=O)Nc3ccccc3Cl)nc2)cc1 |
| InChI | InChI=1S/C20H16ClN3O3/c1-27-20(26)13-6-8-14(9-7-13)23-15-10-11-18(22-12-15)19(25)24-17-5-3-2-4-16(17)21/h2-12,23H,1H3,(H,24,25) |
| InChIKey | LPIVKFRTFHJKMC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |