C14H14N4O5S — CID 55559964
methyl 6-[[3-(sulfamoylamino)phenyl]carbamoyl]pyridine-3-carboxylate (PubChem CID 55559964) has the molecular formula C14H14N4O5S and a molecular weight of 350.36 g/mol. Its IUPAC name is methyl 6-[[3-(sulfamoylamino)phenyl]carbamoyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[[3-(sulfamoylamino)phenyl]carbamoyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55559964 |
| Molecular Formula | C14H14N4O5S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | methyl 6-[[3-(sulfamoylamino)phenyl]carbamoyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cccc(NS(N)(=O)=O)c2)nc1 |
| InChI | InChI=1S/C14H14N4O5S/c1-23-14(20)9-5-6-12(16-8-9)13(19)17-10-3-2-4-11(7-10)18-24(15,21)22/h2-8,18H,1H3,(H,17,19)(H2,15,21,22) |
| InChIKey | SEDBLHYRKKJOTB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 140.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |