C14H11F3N2O2 — CID 61307392
methyl 5-amino-2-(2,3,4-trifluoroanilino)benzoate (PubChem CID 61307392) has the molecular formula C14H11F3N2O2 and a molecular weight of 296.25 g/mol. Its IUPAC name is methyl 5-amino-2-(2,3,4-trifluoroanilino)benzoate.
| Compound Name | methyl 5-amino-2-(2,3,4-trifluoroanilino)benzoate |
|---|---|
| PubChem CID | 61307392 |
| Molecular Formula | C14H11F3N2O2 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | methyl 5-amino-2-(2,3,4-trifluoroanilino)benzoate |
| SMILES | COC(=O)c1cc(N)ccc1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H11F3N2O2/c1-21-14(20)8-6-7(18)2-4-10(8)19-11-5-3-9(15)12(16)13(11)17/h2-6,19H,18H2,1H3 |
| InChIKey | TVEJEHIDHXRHAJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|