C8H7F2NO2 — CID 22621156
methyl 2-amino-3,4-difluorobenzoate (PubChem CID 22621156) has the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. Its IUPAC name is methyl 2-amino-3,4-difluorobenzoate.
| Compound Name | methyl 2-amino-3,4-difluorobenzoate |
|---|---|
| PubChem CID | 22621156 |
| Molecular Formula | C8H7F2NO2 |
| Molecular Weight | 187.14 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | methyl 2-amino-3,4-difluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(F)c1N |
| InChI | InChI=1S/C8H7F2NO2/c1-13-8(12)4-2-3-5(9)6(10)7(4)11/h2-3H,11H2,1H3 |
| InChIKey | MQSMXRFDHQTFDU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|