C17H21FN2O3Si — CID 156808771
methyl 5-(2-fluoro-4-trimethylsilylanilino)-2-(hydroxymethyl)pyridine-4-carboxylate (PubChem CID 156808771) has the molecular formula C17H21FN2O3Si and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl 5-(2-fluoro-4-trimethylsilylanilino)-2-(hydroxymethyl)pyridine-4-carboxylate.
| Compound Name | methyl 5-(2-fluoro-4-trimethylsilylanilino)-2-(hydroxymethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 156808771 |
| Molecular Formula | C17H21FN2O3Si |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 5-(2-fluoro-4-trimethylsilylanilino)-2-(hydroxymethyl)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(CO)ncc1Nc1ccc([Si](C)(C)C)cc1F |
| InChI | InChI=1S/C17H21FN2O3Si/c1-23-17(22)13-7-11(10-21)19-9-16(13)20-15-6-5-12(8-14(15)18)24(2,3)4/h5-9,20-21H,10H2,1-4H3 |
| InChIKey | BCAPYHAEHQFPGW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|