C17H14F4N2O2 — CID 170612072
methyl 5-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-4-carboxylate (PubChem CID 170612072) has the molecular formula C17H14F4N2O2 and a molecular weight of 354.30 g/mol. Its IUPAC name is methyl 5-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-4-carboxylate.
| Compound Name | methyl 5-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-4-carboxylate |
|---|---|
| PubChem CID | 170612072 |
| Molecular Formula | C17H14F4N2O2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | methyl 5-(4-fluoro-2-prop-2-enylanilino)-2-(trifluoromethyl)pyridine-4-carboxylate |
| SMILES | C=CCc1cc(F)ccc1Nc1cnc(C(F)(F)F)cc1C(=O)OC |
| InChI | InChI=1S/C17H14F4N2O2/c1-3-4-10-7-11(18)5-6-13(10)23-14-9-22-15(17(19,20)21)8-12(14)16(24)25-2/h3,5-9,23H,1,4H2,2H3 |
| InChIKey | AILBRXMUBGFQFP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|