C17H17ClF4N2O2 — CID 170438032
methyl 2-[2-(2-aminoethyl)-4-fluoroanilino]-5-(trifluoromethyl)benzoate;hydrochloride (PubChem CID 170438032) has the molecular formula C17H17ClF4N2O2 and a molecular weight of 392.78 g/mol. Its IUPAC name is methyl 2-[2-(2-aminoethyl)-4-fluoroanilino]-5-(trifluoromethyl)benzoate;hydrochloride.
| Compound Name | methyl 2-[2-(2-aminoethyl)-4-fluoroanilino]-5-(trifluoromethyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 170438032 |
| Molecular Formula | C17H17ClF4N2O2 |
| Molecular Weight | 392.78 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | methyl 2-[2-(2-aminoethyl)-4-fluoroanilino]-5-(trifluoromethyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1cc(C(F)(F)F)ccc1Nc1ccc(F)cc1CCN.Cl |
| InChI | InChI=1S/C17H16F4N2O2.ClH/c1-25-16(24)13-9-11(17(19,20)21)2-4-15(13)23-14-5-3-12(18)8-10(14)6-7-22;/h2-5,8-9,23H,6-7,22H2,1H3;1H |
| InChIKey | YBVOGHCMBZZPAI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.78 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |