C10H8F4O3S — CID 122214866
(4-fluoro-2-prop-2-enylphenyl) trifluoromethanesulfonate (PubChem CID 122214866) has the molecular formula C10H8F4O3S and a molecular weight of 284.23 g/mol. Its IUPAC name is (4-fluoro-2-prop-2-enylphenyl) trifluoromethanesulfonate.
| Compound Name | (4-fluoro-2-prop-2-enylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122214866 |
| Molecular Formula | C10H8F4O3S |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | (4-fluoro-2-prop-2-enylphenyl) trifluoromethanesulfonate |
| SMILES | C=CCc1cc(F)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F4O3S/c1-2-3-7-6-8(11)4-5-9(7)17-18(15,16)10(12,13)14/h2,4-6H,1,3H2 |
| InChIKey | BTOWFXJHLYFSOR-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|