C13H13F3O5S — CID 174355923
[3-prop-2-enyl-4-(trifluoromethylsulfonyloxy)phenyl] propanoate (PubChem CID 174355923) has the molecular formula C13H13F3O5S and a molecular weight of 338.30 g/mol. Its IUPAC name is [3-prop-2-enyl-4-(trifluoromethylsulfonyloxy)phenyl] propanoate.
| Compound Name | [3-prop-2-enyl-4-(trifluoromethylsulfonyloxy)phenyl] propanoate |
|---|---|
| PubChem CID | 174355923 |
| Molecular Formula | C13H13F3O5S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [3-prop-2-enyl-4-(trifluoromethylsulfonyloxy)phenyl] propanoate |
| SMILES | C=CCc1cc(OC(=O)CC)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3O5S/c1-3-5-9-8-10(20-12(17)4-2)6-7-11(9)21-22(18,19)13(14,15)16/h3,6-8H,1,4-5H2,2H3 |
| InChIKey | WFCBVRHLZMEMDQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|