C16H20O3 — CID 174367755
[4-hydroxy-3,5-bis(prop-2-enyl)phenyl] butanoate (PubChem CID 174367755) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is [4-hydroxy-3,5-bis(prop-2-enyl)phenyl] butanoate.
| Compound Name | [4-hydroxy-3,5-bis(prop-2-enyl)phenyl] butanoate |
|---|---|
| PubChem CID | 174367755 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | [4-hydroxy-3,5-bis(prop-2-enyl)phenyl] butanoate |
| SMILES | C=CCc1cc(OC(=O)CCC)cc(CC=C)c1O |
| InChI | InChI=1S/C16H20O3/c1-4-7-12-10-14(19-15(17)9-6-3)11-13(8-5-2)16(12)18/h4-5,10-11,18H,1-2,6-9H2,3H3 |
| InChIKey | XTBUSCGFKBFSIN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|