C11H12I2O3 — CID 155166186
(4-hydroxy-3,5-diiodophenyl) pentanoate (PubChem CID 155166186) has the molecular formula C11H12I2O3 and a molecular weight of 446.02 g/mol. Its IUPAC name is (4-hydroxy-3,5-diiodophenyl) pentanoate.
| Compound Name | (4-hydroxy-3,5-diiodophenyl) pentanoate |
|---|---|
| PubChem CID | 155166186 |
| Molecular Formula | C11H12I2O3 |
| Molecular Weight | 446.02 g/mol |
| Exact Mass | 445.89 |
| IUPAC Name | (4-hydroxy-3,5-diiodophenyl) pentanoate |
| SMILES | CCCCC(=O)Oc1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C11H12I2O3/c1-2-3-4-10(14)16-7-5-8(12)11(15)9(13)6-7/h5-6,15H,2-4H2,1H3 |
| InChIKey | VKHQOWKCAFQGKH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.02 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|