C18H14ClF3O5S — CID 87858014
prop-1-en-2-yl 2-[4-[3-chloro-4-(trifluoromethylsulfonyloxy)phenyl]phenyl]acetate (PubChem CID 87858014) has the molecular formula C18H14ClF3O5S and a molecular weight of 434.82 g/mol. Its IUPAC name is prop-1-en-2-yl 2-[4-[3-chloro-4-(trifluoromethylsulfonyloxy)phenyl]phenyl]acetate.
| Compound Name | prop-1-en-2-yl 2-[4-[3-chloro-4-(trifluoromethylsulfonyloxy)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 87858014 |
| Molecular Formula | C18H14ClF3O5S |
| Molecular Weight | 434.82 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | prop-1-en-2-yl 2-[4-[3-chloro-4-(trifluoromethylsulfonyloxy)phenyl]phenyl]acetate |
| SMILES | C=C(C)OC(=O)Cc1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C18H14ClF3O5S/c1-11(2)26-17(23)9-12-3-5-13(6-4-12)14-7-8-16(15(19)10-14)27-28(24,25)18(20,21)22/h3-8,10H,1,9H2,2H3 |
| InChIKey | OGHKGURHIPTOTD-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.82 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|