C35H35F9O9S3 — CID 158365524
2-methyl-4-(4-propylphenyl)phenol;[2-methyl-4-(4-propylphenyl)phenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate (PubChem CID 158365524) has the molecular formula C35H35F9O9S3 and a molecular weight of 866.84 g/mol. Its IUPAC name is 2-methyl-4-(4-propylphenyl)phenol;[2-methyl-4-(4-propylphenyl)phenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate.
| Compound Name | 2-methyl-4-(4-propylphenyl)phenol;[2-methyl-4-(4-propylphenyl)phenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 158365524 |
| Molecular Formula | C35H35F9O9S3 |
| Molecular Weight | 866.84 g/mol |
| Exact Mass | 866.13 |
| IUPAC Name | 2-methyl-4-(4-propylphenyl)phenol;[2-methyl-4-(4-propylphenyl)phenyl] trifluoromethanesulfonate;trifluoromethylsulfonyl trifluoromethanesulfonate |
| SMILES | CCCc1ccc(-c2ccc(O)c(C)c2)cc1.CCCc1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(C)c2)cc1.O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H17F3O3S.C16H18O.C2F6O5S2/c1-3-4-13-5-7-14(8-6-13)15-9-10-16(12(2)11-15)23-24(21,22)17(18,19)20;1-3-4-13-5-7-14(8-6-13)15-9-10-16(17)12(2)11-15;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h5-11H,3-4H2,1-2H3;5-11,17H,3-4H2,1-2H3; |
| InChIKey | GTZFOJOICKZDSU-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 866.84 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|