C18H18F4O4S — CID 89362065
[4-(4-butoxy-3-fluorophenyl)-2-methylphenyl] trifluoromethanesulfonate (PubChem CID 89362065) has the molecular formula C18H18F4O4S and a molecular weight of 406.40 g/mol. Its IUPAC name is [4-(4-butoxy-3-fluorophenyl)-2-methylphenyl] trifluoromethanesulfonate.
| Compound Name | [4-(4-butoxy-3-fluorophenyl)-2-methylphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89362065 |
| Molecular Formula | C18H18F4O4S |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | [4-(4-butoxy-3-fluorophenyl)-2-methylphenyl] trifluoromethanesulfonate |
| SMILES | CCCCOc1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)c(C)c2)cc1F |
| InChI | InChI=1S/C18H18F4O4S/c1-3-4-9-25-17-8-6-14(11-15(17)19)13-5-7-16(12(2)10-13)26-27(23,24)18(20,21)22/h5-8,10-11H,3-4,9H2,1-2H3 |
| InChIKey | LHIMSOGNPBKUED-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|