C22H17F7O3S — CID 139849944
[6-(2,6-difluoro-4-pentylphenyl)-1,8-difluoronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 139849944) has the molecular formula C22H17F7O3S and a molecular weight of 494.43 g/mol. Its IUPAC name is [6-(2,6-difluoro-4-pentylphenyl)-1,8-difluoronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(2,6-difluoro-4-pentylphenyl)-1,8-difluoronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139849944 |
| Molecular Formula | C22H17F7O3S |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | [6-(2,6-difluoro-4-pentylphenyl)-1,8-difluoronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCCc1cc(F)c(-c2cc(F)c3c(F)c(OS(=O)(=O)C(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C22H17F7O3S/c1-2-3-4-5-12-8-15(23)19(16(24)9-12)14-10-13-6-7-18(21(26)20(13)17(25)11-14)32-33(30,31)22(27,28)29/h6-11H,2-5H2,1H3 |
| InChIKey | GEJVTSNDAAXSHO-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|