C21H20F2O — CID 139849886
1,8-difluoro-6-(4-pentylphenyl)naphthalen-2-ol (PubChem CID 139849886) has the molecular formula C21H20F2O and a molecular weight of 326.39 g/mol. Its IUPAC name is 1,8-difluoro-6-(4-pentylphenyl)naphthalen-2-ol.
| Compound Name | 1,8-difluoro-6-(4-pentylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 139849886 |
| Molecular Formula | C21H20F2O |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1,8-difluoro-6-(4-pentylphenyl)naphthalen-2-ol |
| SMILES | CCCCCc1ccc(-c2cc(F)c3c(F)c(O)ccc3c2)cc1 |
| InChI | InChI=1S/C21H20F2O/c1-2-3-4-5-14-6-8-15(9-7-14)17-12-16-10-11-19(24)21(23)20(16)18(22)13-17/h6-13,24H,2-5H2,1H3 |
| InChIKey | GZDJDWXZCSETCB-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|