C25H24F6O — CID 139855963
1,3,8-trifluoro-6-(4-heptylphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855963) has the molecular formula C25H24F6O and a molecular weight of 454.45 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-(4-heptylphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 1,3,8-trifluoro-6-(4-heptylphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855963 |
| Molecular Formula | C25H24F6O |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 1,3,8-trifluoro-6-(4-heptylphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | CCCCCCCc1ccc(-c2cc(F)c3c(F)c(OCC(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C25H24F6O/c1-2-3-4-5-6-7-16-8-10-17(11-9-16)18-12-19-14-21(27)24(32-15-25(29,30)31)23(28)22(19)20(26)13-18/h8-14H,2-7,15H2,1H3 |
| InChIKey | MJNVNCMHVJHXSI-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|