C21H14F6O2 — CID 139855511
1,3,8-trifluoro-6-(4-prop-2-enoxyphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855511) has the molecular formula C21H14F6O2 and a molecular weight of 412.33 g/mol. Its IUPAC name is 1,3,8-trifluoro-6-(4-prop-2-enoxyphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 1,3,8-trifluoro-6-(4-prop-2-enoxyphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855511 |
| Molecular Formula | C21H14F6O2 |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1,3,8-trifluoro-6-(4-prop-2-enoxyphenyl)-2-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | C=CCOc1ccc(-c2cc(F)c3c(F)c(OCC(F)(F)F)c(F)cc3c2)cc1 |
| InChI | InChI=1S/C21H14F6O2/c1-2-7-28-15-5-3-12(4-6-15)13-8-14-10-17(23)20(29-11-21(25,26)27)19(24)18(14)16(22)9-13/h2-6,8-10H,1,7,11H2 |
| InChIKey | GPAXFHFVQGKXSK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|