C19H17F5O — CID 139764142
1,3-difluoro-5-(4-pent-3-enylphenyl)-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 139764142) has the molecular formula C19H17F5O and a molecular weight of 356.33 g/mol. Its IUPAC name is 1,3-difluoro-5-(4-pent-3-enylphenyl)-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1,3-difluoro-5-(4-pent-3-enylphenyl)-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 139764142 |
| Molecular Formula | C19H17F5O |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 1,3-difluoro-5-(4-pent-3-enylphenyl)-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CC=CCCc1ccc(-c2cc(F)c(OCC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H17F5O/c1-2-3-4-5-13-6-8-14(9-7-13)15-10-16(20)18(17(21)11-15)25-12-19(22,23)24/h2-3,6-11H,4-5,12H2,1H3 |
| InChIKey | ONVBTUZTLQHLJA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|