C23H19F5O — CID 139855208
2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene (PubChem CID 139855208) has the molecular formula C23H19F5O and a molecular weight of 406.39 g/mol. Its IUPAC name is 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene.
| Compound Name | 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene |
|---|---|
| PubChem CID | 139855208 |
| Molecular Formula | C23H19F5O |
| Molecular Weight | 406.39 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-6-(2,2,2-trifluoroethoxy)naphthalene |
| SMILES | C/C=C/CCc1cc(F)c(-c2ccc3cc(OCC(F)(F)F)ccc3c2)c(F)c1 |
| InChI | InChI=1S/C23H19F5O/c1-2-3-4-5-15-10-20(24)22(21(25)11-15)18-7-6-17-13-19(9-8-16(17)12-18)29-14-23(26,27)28/h2-3,6-13H,4-5,14H2,1H3/b3-2+ |
| InChIKey | IWXAUZWIEXKPCR-NSCUHMNNSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.39 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|