C22H16F6O — CID 139855298
2-(difluoromethoxy)-6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoronaphthalene (PubChem CID 139855298) has the molecular formula C22H16F6O and a molecular weight of 410.36 g/mol. Its IUPAC name is 2-(difluoromethoxy)-6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoronaphthalene.
| Compound Name | 2-(difluoromethoxy)-6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoronaphthalene |
|---|---|
| PubChem CID | 139855298 |
| Molecular Formula | C22H16F6O |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-(difluoromethoxy)-6-[2,6-difluoro-4-[(E)-pent-3-enyl]phenyl]-1,3-difluoronaphthalene |
| SMILES | C/C=C/CCc1cc(F)c(-c2ccc3c(F)c(OC(F)F)c(F)cc3c2)c(F)c1 |
| InChI | InChI=1S/C22H16F6O/c1-2-3-4-5-12-8-16(23)19(17(24)9-12)13-6-7-15-14(10-13)11-18(25)21(20(15)26)29-22(27)28/h2-3,6-11,22H,4-5H2,1H3/b3-2+ |
| InChIKey | QOGZMGZYWDSJFS-NSCUHMNNSA-N |
| XLogP | 7.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|