C26H25F3O2 — CID 139863150
6-but-2-enoxy-3-(difluoromethoxy)-1-fluoro-2-[4-[(E)-pent-3-enyl]phenyl]naphthalene (PubChem CID 139863150) has the molecular formula C26H25F3O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 6-but-2-enoxy-3-(difluoromethoxy)-1-fluoro-2-[4-[(E)-pent-3-enyl]phenyl]naphthalene.
| Compound Name | 6-but-2-enoxy-3-(difluoromethoxy)-1-fluoro-2-[4-[(E)-pent-3-enyl]phenyl]naphthalene |
|---|---|
| PubChem CID | 139863150 |
| Molecular Formula | C26H25F3O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 6-but-2-enoxy-3-(difluoromethoxy)-1-fluoro-2-[4-[(E)-pent-3-enyl]phenyl]naphthalene |
| SMILES | CC=CCOc1ccc2c(F)c(-c3ccc(CC/C=C/C)cc3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C26H25F3O2/c1-3-5-7-8-18-9-11-19(12-10-18)24-23(31-26(28)29)17-20-16-21(30-15-6-4-2)13-14-22(20)25(24)27/h3-6,9-14,16-17,26H,7-8,15H2,1-2H3/b5-3+,6-4? |
| InChIKey | FNEMAIPNGBDGPC-UHMKDZKBSA-N |
| XLogP | 7.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|