C21H19F3O2 — CID 139862827
3-(difluoromethoxy)-6-ethoxy-2-(4-ethylphenyl)-1-fluoronaphthalene (PubChem CID 139862827) has the molecular formula C21H19F3O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-(difluoromethoxy)-6-ethoxy-2-(4-ethylphenyl)-1-fluoronaphthalene.
| Compound Name | 3-(difluoromethoxy)-6-ethoxy-2-(4-ethylphenyl)-1-fluoronaphthalene |
|---|---|
| PubChem CID | 139862827 |
| Molecular Formula | C21H19F3O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 3-(difluoromethoxy)-6-ethoxy-2-(4-ethylphenyl)-1-fluoronaphthalene |
| SMILES | CCOc1ccc2c(F)c(-c3ccc(CC)cc3)c(OC(F)F)cc2c1 |
| InChI | InChI=1S/C21H19F3O2/c1-3-13-5-7-14(8-6-13)19-18(26-21(23)24)12-15-11-16(25-4-2)9-10-17(15)20(19)22/h5-12,21H,3-4H2,1-2H3 |
| InChIKey | LWXZMAJVYUETQI-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |