C20H18F2O — CID 139863236
7-ethoxy-3-(4-ethylphenyl)-1,2-difluoronaphthalene (PubChem CID 139863236) has the molecular formula C20H18F2O and a molecular weight of 312.36 g/mol. Its IUPAC name is 7-ethoxy-3-(4-ethylphenyl)-1,2-difluoronaphthalene.
| Compound Name | 7-ethoxy-3-(4-ethylphenyl)-1,2-difluoronaphthalene |
|---|---|
| PubChem CID | 139863236 |
| Molecular Formula | C20H18F2O |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 7-ethoxy-3-(4-ethylphenyl)-1,2-difluoronaphthalene |
| SMILES | CCOc1ccc2cc(-c3ccc(CC)cc3)c(F)c(F)c2c1 |
| InChI | InChI=1S/C20H18F2O/c1-3-13-5-7-14(8-6-13)17-11-15-9-10-16(23-4-2)12-18(15)20(22)19(17)21/h5-12H,3-4H2,1-2H3 |
| InChIKey | ZGJYSIOEKQNANK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |