C23H23FO — CID 139861883
2-(4-ethoxyphenyl)-1-fluoro-6-[(E)-pent-3-enyl]naphthalene (PubChem CID 139861883) has the molecular formula C23H23FO and a molecular weight of 334.43 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-1-fluoro-6-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 2-(4-ethoxyphenyl)-1-fluoro-6-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139861883 |
| Molecular Formula | C23H23FO |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-(4-ethoxyphenyl)-1-fluoro-6-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2c(F)c(-c3ccc(OCC)cc3)ccc2c1 |
| InChI | InChI=1S/C23H23FO/c1-3-5-6-7-17-8-14-22-19(16-17)11-15-21(23(22)24)18-9-12-20(13-10-18)25-4-2/h3,5,8-16H,4,6-7H2,1-2H3/b5-3+ |
| InChIKey | RSCYPOSDZKKTQE-HWKANZROSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|