C24H16F6O — CID 139851474
2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[(E)-pent-3-enyl]naphthalene (PubChem CID 139851474) has the molecular formula C24H16F6O and a molecular weight of 434.38 g/mol. Its IUPAC name is 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[(E)-pent-3-enyl]naphthalene.
| Compound Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[(E)-pent-3-enyl]naphthalene |
|---|---|
| PubChem CID | 139851474 |
| Molecular Formula | C24H16F6O |
| Molecular Weight | 434.38 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | 2-[2-[3,5-difluoro-4-(trifluoromethoxy)phenyl]ethynyl]-1-fluoro-6-[(E)-pent-3-enyl]naphthalene |
| SMILES | C/C=C/CCc1ccc2c(F)c(C#Cc3cc(F)c(OC(F)(F)F)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C24H16F6O/c1-2-3-4-5-15-7-11-19-18(12-15)10-9-17(22(19)27)8-6-16-13-20(25)23(21(26)14-16)31-24(28,29)30/h2-3,7,9-14H,4-5H2,1H3/b3-2+ |
| InChIKey | VOOMEJAARLIJEG-NSCUHMNNSA-N |
| XLogP | 7.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.38 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|