About 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran
2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran (PubChem CID 134369998) has the molecular formula C18H16F2O3
and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran.
Molecular Properties
| Compound Name | 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran |
| PubChem CID | 134369998 |
| Molecular Formula | C18H16F2O3 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran |
| SMILES | CCOc1ccc(-c2cc3cc(OCC)oc3c(F)c2F)cc1 |
| InChI | InChI=1S/C18H16F2O3/c1-3-21-13-7-5-11(6-8-13)14-9-12-10-15(22-4-2)23-18(12)17(20)16(14)19/h5-10H,3-4H2,1-2H3 |
| InChIKey | APAKOMMPIDJSCN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran?
The IUPAC name of 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran (CID 134369998) is 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran.
What is the SMILES notation for 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran?
The canonical SMILES for 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran is CCOc1ccc(-c2cc3cc(OCC)oc3c(F)c2F)cc1.
What is the InChIKey of 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran?
The InChIKey is APAKOMMPIDJSCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2O3/c1-3-21-13-7-5-11(6-8-13)14-9-12-10-15(22-4-2)23-18(12)17(20)16(14)19/h5-10H,3-4H2,1-2H3.
What are the key properties of 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran?
2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran has a molecular weight of 318.32 g/mol, XLogP of 5.18, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran is sourced from PubChem (CID 134369998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).