C18H16F2O3 — CID 134369998
2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran (PubChem CID 134369998) has the molecular formula C18H16F2O3 and a molecular weight of 318.32 g/mol. Its IUPAC name is 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran.
| Compound Name | 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran |
|---|---|
| PubChem CID | 134369998 |
| Molecular Formula | C18H16F2O3 |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-ethoxy-5-(4-ethoxyphenyl)-6,7-difluoro-1-benzofuran |
| SMILES | CCOc1ccc(-c2cc3cc(OCC)oc3c(F)c2F)cc1 |
| InChI | InChI=1S/C18H16F2O3/c1-3-21-13-7-5-11(6-8-13)14-9-12-10-15(22-4-2)23-18(12)17(20)16(14)19/h5-10H,3-4H2,1-2H3 |
| InChIKey | APAKOMMPIDJSCN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |