About 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene
1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene (PubChem CID 102107655) has the molecular formula C22H20F2O2
and a molecular weight of 354.40 g/mol. Its IUPAC name is 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene |
| PubChem CID | 102107655 |
| Molecular Formula | C22H20F2O2 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene |
| SMILES | CCOc1ccc(-c2cc(F)cc(F)c2-c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C22H20F2O2/c1-3-25-18-9-5-15(6-10-18)20-13-17(23)14-21(24)22(20)16-7-11-19(12-8-16)26-4-2/h5-14H,3-4H2,1-2H3 |
| InChIKey | ZEUNPANLDNMAMM-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene?
The IUPAC name of 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene (CID 102107655) is 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene.
What is the SMILES notation for 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene?
The canonical SMILES for 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene is CCOc1ccc(-c2cc(F)cc(F)c2-c2ccc(OCC)cc2)cc1.
What is the InChIKey of 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene?
The InChIKey is ZEUNPANLDNMAMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2O2/c1-3-25-18-9-5-15(6-10-18)20-13-17(23)14-21(24)22(20)16-7-11-19(12-8-16)26-4-2/h5-14H,3-4H2,1-2H3.
What are the key properties of 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene?
1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene has a molecular weight of 354.40 g/mol, XLogP of 6.10, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-ethoxyphenyl)-3,5-difluorobenzene is sourced from PubChem (CID 102107655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).