C18H22N2O3 — CID 70564094
1,4-diethoxy-2-(4-ethoxyphenyl)benzene;molecular nitrogen (PubChem CID 70564094) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1,4-diethoxy-2-(4-ethoxyphenyl)benzene;molecular nitrogen.
| Compound Name | 1,4-diethoxy-2-(4-ethoxyphenyl)benzene;molecular nitrogen |
|---|---|
| PubChem CID | 70564094 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1,4-diethoxy-2-(4-ethoxyphenyl)benzene;molecular nitrogen |
| SMILES | CCOc1ccc(-c2cc(OCC)ccc2OCC)cc1.N#N |
| InChI | InChI=1S/C18H22O3.N2/c1-4-19-15-9-7-14(8-10-15)17-13-16(20-5-2)11-12-18(17)21-6-3;1-2/h7-13H,4-6H2,1-3H3; |
| InChIKey | BGKDGUUMYFPYLG-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|