C32H34O4 — CID 173362856
2-ethoxy-1,3,4-tris(4-ethoxyphenyl)benzene (PubChem CID 173362856) has the molecular formula C32H34O4 and a molecular weight of 482.62 g/mol. Its IUPAC name is 2-ethoxy-1,3,4-tris(4-ethoxyphenyl)benzene.
| Compound Name | 2-ethoxy-1,3,4-tris(4-ethoxyphenyl)benzene |
|---|---|
| PubChem CID | 173362856 |
| Molecular Formula | C32H34O4 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-ethoxy-1,3,4-tris(4-ethoxyphenyl)benzene |
| SMILES | CCOc1ccc(-c2ccc(-c3ccc(OCC)cc3)c(-c3ccc(OCC)cc3)c2OCC)cc1 |
| InChI | InChI=1S/C32H34O4/c1-5-33-26-15-9-23(10-16-26)29-21-22-30(24-11-17-27(18-12-24)34-6-2)32(36-8-4)31(29)25-13-19-28(20-14-25)35-7-3/h9-22H,5-8H2,1-4H3 |
| InChIKey | IIXOEMWKXFRNIN-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |