C48H42O6 — CID 163210798
2,7-diethoxy-1,3,6,8-tetrakis(4-methoxyphenyl)pyrene (PubChem CID 163210798) has the molecular formula C48H42O6 and a molecular weight of 714.86 g/mol. Its IUPAC name is 2,7-diethoxy-1,3,6,8-tetrakis(4-methoxyphenyl)pyrene.
| Compound Name | 2,7-diethoxy-1,3,6,8-tetrakis(4-methoxyphenyl)pyrene |
|---|---|
| PubChem CID | 163210798 |
| Molecular Formula | C48H42O6 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.30 |
| IUPAC Name | 2,7-diethoxy-1,3,6,8-tetrakis(4-methoxyphenyl)pyrene |
| SMILES | CCOc1c(-c2ccc(OC)cc2)c2ccc3c(-c4ccc(OC)cc4)c(OCC)c(-c4ccc(OC)cc4)c4ccc(c1-c1ccc(OC)cc1)c2c34 |
| InChI | InChI=1S/C48H42O6/c1-7-53-47-41(29-9-17-33(49-3)18-10-29)37-25-27-39-43(31-13-21-35(51-5)22-14-31)48(54-8-2)44(32-15-23-36(52-6)24-16-32)40-28-26-38(45(37)46(39)40)42(47)30-11-19-34(50-4)20-12-30/h9-28H,7-8H2,1-6H3 |
| InChIKey | LJQYXWVDQRIMGQ-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|