C22H25NO2 — CID 170561180
3-(4-tert-butylphenyl)-1-ethoxy-6-methoxyisoquinoline (PubChem CID 170561180) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-ethoxy-6-methoxyisoquinoline.
| Compound Name | 3-(4-tert-butylphenyl)-1-ethoxy-6-methoxyisoquinoline |
|---|---|
| PubChem CID | 170561180 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-ethoxy-6-methoxyisoquinoline |
| SMILES | CCOc1nc(-c2ccc(C(C)(C)C)cc2)cc2cc(OC)ccc12 |
| InChI | InChI=1S/C22H25NO2/c1-6-25-21-19-12-11-18(24-5)13-16(19)14-20(23-21)15-7-9-17(10-8-15)22(2,3)4/h7-14H,6H2,1-5H3 |
| InChIKey | KAHJYBGJWYQBHT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |